C20H23BrN4O4S — CID 11191150
2-bromo-N-[[4-[(pyridine-3-carbonylamino)carbamoyl]cyclohexyl]methyl]benzenesulfonamide (PubChem CID 11191150) has the molecular formula C20H23BrN4O4S and a molecular weight of 495.40 g/mol. Its IUPAC name is 2-bromo-N-[[4-[(pyridine-3-carbonylamino)carbamoyl]cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[[4-[(pyridine-3-carbonylamino)carbamoyl]cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11191150 |
| Molecular Formula | C20H23BrN4O4S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 2-bromo-N-[[4-[(pyridine-3-carbonylamino)carbamoyl]cyclohexyl]methyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)C1CCC(CNS(=O)(=O)c2ccccc2Br)CC1)c1cccnc1 |
| InChI | InChI=1S/C20H23BrN4O4S/c21-17-5-1-2-6-18(17)30(28,29)23-12-14-7-9-15(10-8-14)19(26)24-25-20(27)16-4-3-11-22-13-16/h1-6,11,13-15,23H,7-10,12H2,(H,24,26)(H,25,27) |
| InChIKey | BLMIFLZDVPNAHG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|