C21H26N4O4S — CID 11154648
4-methyl-N-[[4-[(pyridine-2-carbonylamino)carbamoyl]cyclohexyl]methyl]benzenesulfonamide (PubChem CID 11154648) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-methyl-N-[[4-[(pyridine-2-carbonylamino)carbamoyl]cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[4-[(pyridine-2-carbonylamino)carbamoyl]cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11154648 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4-methyl-N-[[4-[(pyridine-2-carbonylamino)carbamoyl]cyclohexyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCC(C(=O)NNC(=O)c3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-15-5-11-18(12-6-15)30(28,29)23-14-16-7-9-17(10-8-16)20(26)24-25-21(27)19-4-2-3-13-22-19/h2-6,11-13,16-17,23H,7-10,14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | VWINWDYTZRPRBC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|