C22H33ClN2O3S — CID 5323384
4-[[(4-chlorophenyl)sulfonylamino]methyl]-N-cyclooctylcyclohexane-1-carboxamide (PubChem CID 5323384) has the molecular formula C22H33ClN2O3S and a molecular weight of 441.04 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N-cyclooctylcyclohexane-1-carboxamide.
| Compound Name | 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N-cyclooctylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5323384 |
| Molecular Formula | C22H33ClN2O3S |
| Molecular Weight | 441.04 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N-cyclooctylcyclohexane-1-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)C1CCC(CNS(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H33ClN2O3S/c23-19-12-14-21(15-13-19)29(27,28)24-16-17-8-10-18(11-9-17)22(26)25-20-6-4-2-1-3-5-7-20/h12-15,17-18,20,24H,1-11,16H2,(H,25,26) |
| InChIKey | YVJDGPKLRAOCCE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.04 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |