C20H30ClN3O5S — CID 97263064
4-[[(4-chlorophenyl)sulfonylamino]methyl]-N-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]cyclohexane-1-carboxamide (PubChem CID 97263064) has the molecular formula C20H30ClN3O5S and a molecular weight of 460.00 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 97263064 |
| Molecular Formula | C20H30ClN3O5S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 4-[[(4-chlorophenyl)sulfonylamino]methyl]-N-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]cyclohexane-1-carboxamide |
| SMILES | COCCNC(=O)[C@@H](C)NC(=O)C1CCC(CNS(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H30ClN3O5S/c1-14(19(25)22-11-12-29-2)24-20(26)16-5-3-15(4-6-16)13-23-30(27,28)18-9-7-17(21)8-10-18/h7-10,14-16,23H,3-6,11-13H2,1-2H3,(H,22,25)(H,24,26)/t14-,15?,16?/m1/s1 |
| InChIKey | MFBJVAGGWPATHQ-QQFBHYJXSA-N |
| XLogP | 1.69 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|