C21H33N3O5S — CID 71710458
N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide (PubChem CID 71710458) has the molecular formula C21H33N3O5S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide.
| Compound Name | N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71710458 |
| Molecular Formula | C21H33N3O5S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-4-[[(4-methylphenyl)sulfonylamino]methyl]cyclohexane-1-carboxamide |
| SMILES | COCCNC(=O)C(C)NC(=O)C1CCC(CNS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C21H33N3O5S/c1-15-4-10-19(11-5-15)30(27,28)23-14-17-6-8-18(9-7-17)21(26)24-16(2)20(25)22-12-13-29-3/h4-5,10-11,16-18,23H,6-9,12-14H2,1-3H3,(H,22,25)(H,24,26) |
| InChIKey | AWKCENBFUQTOKC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|