C10H12ClNO4S2 — CID 18072907
4-(cyclopropylmethylsulfamoyl)benzenesulfonyl chloride (PubChem CID 18072907) has the molecular formula C10H12ClNO4S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 4-(cyclopropylmethylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 4-(cyclopropylmethylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 18072907 |
| Molecular Formula | C10H12ClNO4S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 4-(cyclopropylmethylsulfamoyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(S(=O)(=O)NCC2CC2)cc1 |
| InChI | InChI=1S/C10H12ClNO4S2/c11-17(13,14)9-3-5-10(6-4-9)18(15,16)12-7-8-1-2-8/h3-6,8,12H,1-2,7H2 |
| InChIKey | BXQILBYLZOFVQK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |