C12H16ClNO4S2 — CID 43371192
3-(cyclopentylmethylsulfamoyl)benzenesulfonyl chloride (PubChem CID 43371192) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 3-(cyclopentylmethylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 3-(cyclopentylmethylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 43371192 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-(cyclopentylmethylsulfamoyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cccc(S(=O)(=O)NCC2CCCC2)c1 |
| InChI | InChI=1S/C12H16ClNO4S2/c13-19(15,16)11-6-3-7-12(8-11)20(17,18)14-9-10-4-1-2-5-10/h3,6-8,10,14H,1-2,4-5,9H2 |
| InChIKey | KGHINKVTSRPRMP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |