C27H34N2O5S2 — CID 136590042
2-N,7-N-bis(cyclohexylmethyl)-9-oxofluorene-2,7-disulfonamide (PubChem CID 136590042) has the molecular formula C27H34N2O5S2 and a molecular weight of 530.71 g/mol. Its IUPAC name is 2-N,7-N-bis(cyclohexylmethyl)-9-oxofluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(cyclohexylmethyl)-9-oxofluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 136590042 |
| Molecular Formula | C27H34N2O5S2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 2-N,7-N-bis(cyclohexylmethyl)-9-oxofluorene-2,7-disulfonamide |
| SMILES | O=C1c2cc(S(=O)(=O)NCC3CCCCC3)ccc2-c2ccc(S(=O)(=O)NCC3CCCCC3)cc21 |
| InChI | InChI=1S/C27H34N2O5S2/c30-27-25-15-21(35(31,32)28-17-19-7-3-1-4-8-19)11-13-23(25)24-14-12-22(16-26(24)27)36(33,34)29-18-20-9-5-2-6-10-20/h11-16,19-20,28-29H,1-10,17-18H2 |
| InChIKey | NNPBYGFKLPGBOD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |