C23H27N3O5S2 — CID 165385489
2-N,7-N-bis(cyclobutylmethyl)-9-hydroxyiminofluorene-2,7-disulfonamide (PubChem CID 165385489) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-N,7-N-bis(cyclobutylmethyl)-9-hydroxyiminofluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(cyclobutylmethyl)-9-hydroxyiminofluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 165385489 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-N,7-N-bis(cyclobutylmethyl)-9-hydroxyiminofluorene-2,7-disulfonamide |
| SMILES | O=S(=O)(NCC1CCC1)c1ccc2c(c1)C(=NO)c1cc(S(=O)(=O)NCC3CCC3)ccc1-2 |
| InChI | InChI=1S/C23H27N3O5S2/c27-26-23-21-11-17(32(28,29)24-13-15-3-1-4-15)7-9-19(21)20-10-8-18(12-22(20)23)33(30,31)25-14-16-5-2-6-16/h7-12,15-16,24-25,27H,1-6,13-14H2 |
| InChIKey | HGQRZJPJGFMNQA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|