C25H30N2O5S2 — CID 172697362
2-N,7-N-bis(cyclopentylmethyl)-9-oxofluorene-2,7-disulfonamide (PubChem CID 172697362) has the molecular formula C25H30N2O5S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 2-N,7-N-bis(cyclopentylmethyl)-9-oxofluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(cyclopentylmethyl)-9-oxofluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 172697362 |
| Molecular Formula | C25H30N2O5S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-N,7-N-bis(cyclopentylmethyl)-9-oxofluorene-2,7-disulfonamide |
| SMILES | O=C1c2cc(S(=O)(=O)NCC3CCCC3)ccc2-c2ccc(S(=O)(=O)NCC3CCCC3)cc21 |
| InChI | InChI=1S/C25H30N2O5S2/c28-25-23-13-19(33(29,30)26-15-17-5-1-2-6-17)9-11-21(23)22-12-10-20(14-24(22)25)34(31,32)27-16-18-7-3-4-8-18/h9-14,17-18,26-27H,1-8,15-16H2 |
| InChIKey | CMNPHAFJXOPXLZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |