C15H23NO2S — CID 3776153
N-(cyclohexylmethyl)-4-ethylbenzenesulfonamide (PubChem CID 3776153) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4-ethylbenzenesulfonamide.
| Compound Name | N-(cyclohexylmethyl)-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3776153 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(cyclohexylmethyl)-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H23NO2S/c1-2-13-8-10-15(11-9-13)19(17,18)16-12-14-6-4-3-5-7-14/h8-11,14,16H,2-7,12H2,1H3 |
| InChIKey | GMSSTJKOGDHVIK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |