C9H12ClNO5S2 — CID 18071474
3-(2-methoxyethylsulfamoyl)benzenesulfonyl chloride (PubChem CID 18071474) has the molecular formula C9H12ClNO5S2 and a molecular weight of 313.78 g/mol. Its IUPAC name is 3-(2-methoxyethylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 3-(2-methoxyethylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 18071474 |
| Molecular Formula | C9H12ClNO5S2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 3-(2-methoxyethylsulfamoyl)benzenesulfonyl chloride |
| SMILES | COCCNS(=O)(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C9H12ClNO5S2/c1-16-6-5-11-18(14,15)9-4-2-3-8(7-9)17(10,12)13/h2-4,7,11H,5-6H2,1H3 |
| InChIKey | WVJIECCPDDNUDZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|