C16H19NO5S2 — CID 11978633
3-(benzenesulfonyl)-N-(3-methoxypropyl)benzenesulfonamide (PubChem CID 11978633) has the molecular formula C16H19NO5S2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(3-methoxypropyl)benzenesulfonamide.
| Compound Name | 3-(benzenesulfonyl)-N-(3-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11978633 |
| Molecular Formula | C16H19NO5S2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(3-methoxypropyl)benzenesulfonamide |
| SMILES | COCCCNS(=O)(=O)c1cccc(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H19NO5S2/c1-22-12-6-11-17-24(20,21)16-10-5-9-15(13-16)23(18,19)14-7-3-2-4-8-14/h2-5,7-10,13,17H,6,11-12H2,1H3 |
| InChIKey | PKRUKIFASOVUIS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|