C21H21NO4S2 — CID 11978755
3-(benzenesulfonyl)-N-[(2S)-2-phenylpropyl]benzenesulfonamide (PubChem CID 11978755) has the molecular formula C21H21NO4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[(2S)-2-phenylpropyl]benzenesulfonamide.
| Compound Name | 3-(benzenesulfonyl)-N-[(2S)-2-phenylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11978755 |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[(2S)-2-phenylpropyl]benzenesulfonamide |
| SMILES | C[C@H](CNS(=O)(=O)c1cccc(S(=O)(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO4S2/c1-17(18-9-4-2-5-10-18)16-22-28(25,26)21-14-8-13-20(15-21)27(23,24)19-11-6-3-7-12-19/h2-15,17,22H,16H2,1H3/t17-/m1/s1 |
| InChIKey | ATVDTUGKTFQZHP-QGZVFWFLSA-N |
| XLogP | 3.60 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |