C16H20N2O4S — CID 20914102
methyl 1-methyl-4-(2-phenylpropylsulfamoyl)pyrrole-2-carboxylate (PubChem CID 20914102) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl 1-methyl-4-(2-phenylpropylsulfamoyl)pyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-4-(2-phenylpropylsulfamoyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 20914102 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl 1-methyl-4-(2-phenylpropylsulfamoyl)pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCC(C)c2ccccc2)cn1C |
| InChI | InChI=1S/C16H20N2O4S/c1-12(13-7-5-4-6-8-13)10-17-23(20,21)14-9-15(16(19)22-3)18(2)11-14/h4-9,11-12,17H,10H2,1-3H3 |
| InChIKey | CCCWQFIMHXOORN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |