C9H14N2O6S — CID 82706005
4-(2-methoxyethoxysulfamoyl)-1-methylpyrrole-2-carboxylic acid (PubChem CID 82706005) has the molecular formula C9H14N2O6S and a molecular weight of 278.29 g/mol. Its IUPAC name is 4-(2-methoxyethoxysulfamoyl)-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-(2-methoxyethoxysulfamoyl)-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 82706005 |
| Molecular Formula | C9H14N2O6S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 4-(2-methoxyethoxysulfamoyl)-1-methylpyrrole-2-carboxylic acid |
| SMILES | COCCONS(=O)(=O)c1cc(C(=O)O)n(C)c1 |
| InChI | InChI=1S/C9H14N2O6S/c1-11-6-7(5-8(11)9(12)13)18(14,15)10-17-4-3-16-2/h5-6,10H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | CPKIUBNNALUZPL-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|