C13H21N3O5S — CID 46284077
methyl 1-methyl-4-[[3-oxo-3-(propan-2-ylamino)propyl]sulfamoyl]pyrrole-2-carboxylate (PubChem CID 46284077) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is methyl 1-methyl-4-[[3-oxo-3-(propan-2-ylamino)propyl]sulfamoyl]pyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-4-[[3-oxo-3-(propan-2-ylamino)propyl]sulfamoyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46284077 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | methyl 1-methyl-4-[[3-oxo-3-(propan-2-ylamino)propyl]sulfamoyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCC(=O)NC(C)C)cn1C |
| InChI | InChI=1S/C13H21N3O5S/c1-9(2)15-12(17)5-6-14-22(19,20)10-7-11(13(18)21-4)16(3)8-10/h7-9,14H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | KWWSDSFYLCRRNG-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |