C14H21N3O6S — CID 46284104
methyl 1-methyl-4-[(3-morpholin-4-yl-3-oxopropyl)sulfamoyl]pyrrole-2-carboxylate (PubChem CID 46284104) has the molecular formula C14H21N3O6S and a molecular weight of 359.40 g/mol. Its IUPAC name is methyl 1-methyl-4-[(3-morpholin-4-yl-3-oxopropyl)sulfamoyl]pyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-4-[(3-morpholin-4-yl-3-oxopropyl)sulfamoyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46284104 |
| Molecular Formula | C14H21N3O6S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 1-methyl-4-[(3-morpholin-4-yl-3-oxopropyl)sulfamoyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCC(=O)N2CCOCC2)cn1C |
| InChI | InChI=1S/C14H21N3O6S/c1-16-10-11(9-12(16)14(19)22-2)24(20,21)15-4-3-13(18)17-5-7-23-8-6-17/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | ZINZWTBFAWOEIZ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |