C19H25N3O5S — CID 46284093
methyl 1-methyl-4-[[3-oxo-3-(4-propan-2-ylanilino)propyl]sulfamoyl]pyrrole-2-carboxylate (PubChem CID 46284093) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is methyl 1-methyl-4-[[3-oxo-3-(4-propan-2-ylanilino)propyl]sulfamoyl]pyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-4-[[3-oxo-3-(4-propan-2-ylanilino)propyl]sulfamoyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46284093 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl 1-methyl-4-[[3-oxo-3-(4-propan-2-ylanilino)propyl]sulfamoyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCC(=O)Nc2ccc(C(C)C)cc2)cn1C |
| InChI | InChI=1S/C19H25N3O5S/c1-13(2)14-5-7-15(8-6-14)21-18(23)9-10-20-28(25,26)16-11-17(19(24)27-4)22(3)12-16/h5-8,11-13,20H,9-10H2,1-4H3,(H,21,23) |
| InChIKey | IJCSWVULJAUODA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |