C19H25N3O4S — CID 20938643
methyl 4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylsulfamoyl]-1-methylpyrrole-2-carboxylate (PubChem CID 20938643) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is methyl 4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylsulfamoyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylsulfamoyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 20938643 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | methyl 4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylsulfamoyl]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCCN2CCCc3ccccc32)cn1C |
| InChI | InChI=1S/C19H25N3O4S/c1-21-14-16(13-18(21)19(23)26-2)27(24,25)20-10-6-12-22-11-5-8-15-7-3-4-9-17(15)22/h3-4,7,9,13-14,20H,5-6,8,10-12H2,1-2H3 |
| InChIKey | BRINYORRUHNSSJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|