C20H24N2O4S — CID 37309226
methyl 3-[3-(2,3-dihydroindol-1-yl)propylsulfamoyl]-4-methylbenzoate (PubChem CID 37309226) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl 3-[3-(2,3-dihydroindol-1-yl)propylsulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[3-(2,3-dihydroindol-1-yl)propylsulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 37309226 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl 3-[3-(2,3-dihydroindol-1-yl)propylsulfamoyl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)NCCCN2CCc3ccccc32)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-15-8-9-17(20(23)26-2)14-19(15)27(24,25)21-11-5-12-22-13-10-16-6-3-4-7-18(16)22/h3-4,6-9,14,21H,5,10-13H2,1-2H3 |
| InChIKey | BXOXIDRMAFIKQD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|