C13H18N2O4S — CID 170563671
methyl 3-[2-(aziridin-1-yl)ethylsulfamoyl]-4-methylbenzoate (PubChem CID 170563671) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl 3-[2-(aziridin-1-yl)ethylsulfamoyl]-4-methylbenzoate.
| Compound Name | methyl 3-[2-(aziridin-1-yl)ethylsulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 170563671 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 3-[2-(aziridin-1-yl)ethylsulfamoyl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)NCCN2CC2)c1 |
| InChI | InChI=1S/C13H18N2O4S/c1-10-3-4-11(13(16)19-2)9-12(10)20(17,18)14-5-6-15-7-8-15/h3-4,9,14H,5-8H2,1-2H3 |
| InChIKey | NWXRQKWHWRPIAL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|