C16H18N2O4S — CID 37265699
methyl 4-methyl-3-(2-pyridin-3-ylethylsulfamoyl)benzoate (PubChem CID 37265699) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is methyl 4-methyl-3-(2-pyridin-3-ylethylsulfamoyl)benzoate.
| Compound Name | methyl 4-methyl-3-(2-pyridin-3-ylethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 37265699 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | methyl 4-methyl-3-(2-pyridin-3-ylethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)NCCc2cccnc2)c1 |
| InChI | InChI=1S/C16H18N2O4S/c1-12-5-6-14(16(19)22-2)10-15(12)23(20,21)18-9-7-13-4-3-8-17-11-13/h3-6,8,10-11,18H,7,9H2,1-2H3 |
| InChIKey | NAIMNIMWKCWIRR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |