C16H27Cl2N3O4S — CID 119994439
methyl 4-methyl-3-(3-piperazin-1-ylpropylsulfamoyl)benzoate;dihydrochloride (PubChem CID 119994439) has the molecular formula C16H27Cl2N3O4S and a molecular weight of 428.38 g/mol. Its IUPAC name is methyl 4-methyl-3-(3-piperazin-1-ylpropylsulfamoyl)benzoate;dihydrochloride.
| Compound Name | methyl 4-methyl-3-(3-piperazin-1-ylpropylsulfamoyl)benzoate;dihydrochloride |
|---|---|
| PubChem CID | 119994439 |
| Molecular Formula | C16H27Cl2N3O4S |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | methyl 4-methyl-3-(3-piperazin-1-ylpropylsulfamoyl)benzoate;dihydrochloride |
| SMILES | COC(=O)c1ccc(C)c(S(=O)(=O)NCCCN2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C16H25N3O4S.2ClH/c1-13-4-5-14(16(20)23-2)12-15(13)24(21,22)18-6-3-9-19-10-7-17-8-11-19;;/h4-5,12,17-18H,3,6-11H2,1-2H3;2*1H |
| InChIKey | DGXRTFSAQBDSOF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|