C14H23N3O5S — CID 119994394
methyl 2-methyl-5-(3-piperazin-1-ylpropylsulfamoyl)furan-3-carboxylate (PubChem CID 119994394) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is methyl 2-methyl-5-(3-piperazin-1-ylpropylsulfamoyl)furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-(3-piperazin-1-ylpropylsulfamoyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 119994394 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | methyl 2-methyl-5-(3-piperazin-1-ylpropylsulfamoyl)furan-3-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCCN2CCNCC2)oc1C |
| InChI | InChI=1S/C14H23N3O5S/c1-11-12(14(18)21-2)10-13(22-11)23(19,20)16-4-3-7-17-8-5-15-6-9-17/h10,15-16H,3-9H2,1-2H3 |
| InChIKey | TXCBARHLPRIKPL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|