C10H13N5O5S — CID 146090438
methyl 2-methyl-5-[2-(tetrazol-2-yl)ethylsulfamoyl]furan-3-carboxylate (PubChem CID 146090438) has the molecular formula C10H13N5O5S and a molecular weight of 315.31 g/mol. Its IUPAC name is methyl 2-methyl-5-[2-(tetrazol-2-yl)ethylsulfamoyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[2-(tetrazol-2-yl)ethylsulfamoyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 146090438 |
| Molecular Formula | C10H13N5O5S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | methyl 2-methyl-5-[2-(tetrazol-2-yl)ethylsulfamoyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCCn2ncnn2)oc1C |
| InChI | InChI=1S/C10H13N5O5S/c1-7-8(10(16)19-2)5-9(20-7)21(17,18)13-3-4-15-12-6-11-14-15/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | NKSUYPPVZZVORH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |