C12H18N2O5S — CID 119959348
methyl 5-(4-aminopiperidin-1-yl)sulfonyl-2-methylfuran-3-carboxylate (PubChem CID 119959348) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is methyl 5-(4-aminopiperidin-1-yl)sulfonyl-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-(4-aminopiperidin-1-yl)sulfonyl-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 119959348 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | methyl 5-(4-aminopiperidin-1-yl)sulfonyl-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCC(N)CC2)oc1C |
| InChI | InChI=1S/C12H18N2O5S/c1-8-10(12(15)18-2)7-11(19-8)20(16,17)14-5-3-9(13)4-6-14/h7,9H,3-6,13H2,1-2H3 |
| InChIKey | DKCYCMFCEUZBPX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |