About methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate
methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate (PubChem CID 120778972) has the molecular formula C14H22N2O5S
and a molecular weight of 330.41 g/mol. Its IUPAC name is methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate |
| PubChem CID | 120778972 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)N2CCC(N)C(C)(C)C2)c(C)o1 |
| InChI | InChI=1S/C14H22N2O5S/c1-9-11(7-10(21-9)13(17)20-4)22(18,19)16-6-5-12(15)14(2,3)8-16/h7,12H,5-6,8,15H2,1-4H3 |
| InChIKey | HUZYXDRCNGJAJC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate?
The IUPAC name of methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate (CID 120778972) is methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate.
What is the SMILES notation for methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate?
The canonical SMILES for methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate is COC(=O)c1cc(S(=O)(=O)N2CCC(N)C(C)(C)C2)c(C)o1.
What is the InChIKey of methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate?
The InChIKey is HUZYXDRCNGJAJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O5S/c1-9-11(7-10(21-9)13(17)20-4)22(18,19)16-6-5-12(15)14(2,3)8-16/h7,12H,5-6,8,15H2,1-4H3.
What are the key properties of methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate?
methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate has a molecular weight of 330.41 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-5-methylfuran-2-carboxylate is sourced from PubChem (CID 120778972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).