About methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride
methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride (PubChem CID 120877013) has the molecular formula C14H23ClN2O4S2
and a molecular weight of 382.94 g/mol. Its IUPAC name is methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride |
| PubChem CID | 120877013 |
| Molecular Formula | C14H23ClN2O4S2 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)N1CCC(N)C(C)(C)C1.Cl |
| InChI | InChI=1S/C14H22N2O4S2.ClH/c1-9-7-21-11(13(17)20-4)12(9)22(18,19)16-6-5-10(15)14(2,3)8-16;/h7,10H,5-6,8,15H2,1-4H3;1H |
| InChIKey | YCUHLWHHMASXSH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride?
The IUPAC name of methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride (CID 120877013) is methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride is COC(=O)c1scc(C)c1S(=O)(=O)N1CCC(N)C(C)(C)C1.Cl.
What is the InChIKey of methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride?
The InChIKey is YCUHLWHHMASXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O4S2.ClH/c1-9-7-21-11(13(17)20-4)12(9)22(18,19)16-6-5-10(15)14(2,3)8-16;/h7,10H,5-6,8,15H2,1-4H3;1H.
What are the key properties of methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride?
methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride has a molecular weight of 382.94 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-amino-3,3-dimethylpiperidin-1-yl)sulfonyl-4-methylthiophene-2-carboxylate;hydrochloride is sourced from PubChem (CID 120877013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).