C13H17NO4S2 — CID 106313476
methyl 4-methyl-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophene-2-carboxylate (PubChem CID 106313476) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is methyl 4-methyl-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 106313476 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | methyl 4-methyl-3-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)N1CCC=C(C)C1 |
| InChI | InChI=1S/C13H17NO4S2/c1-9-5-4-6-14(7-9)20(16,17)12-10(2)8-19-11(12)13(15)18-3/h5,8H,4,6-7H2,1-3H3 |
| InChIKey | QVYNRPFLUAFKSP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|