C11H16N2O5S2 — CID 102749171
methyl 4-methyl-3-(morpholin-4-ylsulfamoyl)thiophene-2-carboxylate (PubChem CID 102749171) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 4-methyl-3-(morpholin-4-ylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-(morpholin-4-ylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749171 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | methyl 4-methyl-3-(morpholin-4-ylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NN1CCOCC1 |
| InChI | InChI=1S/C11H16N2O5S2/c1-8-7-19-9(11(14)17-2)10(8)20(15,16)12-13-3-5-18-6-4-13/h7,12H,3-6H2,1-2H3 |
| InChIKey | HUEXKOFYFUXANL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |