C12H17NO4S2 — CID 102749299
methyl 4-methyl-3-[(1-methylcyclobutyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 102749299) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is methyl 4-methyl-3-[(1-methylcyclobutyl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[(1-methylcyclobutyl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102749299 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | methyl 4-methyl-3-[(1-methylcyclobutyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NC1(C)CCC1 |
| InChI | InChI=1S/C12H17NO4S2/c1-8-7-18-9(11(14)17-3)10(8)19(15,16)13-12(2)5-4-6-12/h7,13H,4-6H2,1-3H3 |
| InChIKey | IHCWHKCNXORCLH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |