C13H20N2O4S2 — CID 120874977
methyl 4-methyl-3-[3-(methylaminomethyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 120874977) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is methyl 4-methyl-3-[3-(methylaminomethyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-[3-(methylaminomethyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 120874977 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl 4-methyl-3-[3-(methylaminomethyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | CNCC1CCN(S(=O)(=O)c2c(C)csc2C(=O)OC)C1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-9-8-20-11(13(16)19-3)12(9)21(17,18)15-5-4-10(7-15)6-14-2/h8,10,14H,4-7H2,1-3H3 |
| InChIKey | AYASGPYLCGTUSK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |