C14H20N2O5S — CID 119968151
methyl 5-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)-2-methylfuran-3-carboxylate (PubChem CID 119968151) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl 5-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 119968151 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 5-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC2CC3CCC(C2)N3)oc1C |
| InChI | InChI=1S/C14H20N2O5S/c1-8-12(14(17)20-2)7-13(21-8)22(18,19)16-11-5-9-3-4-10(6-11)15-9/h7,9-11,15-16H,3-6H2,1-2H3 |
| InChIKey | SEYHKSPTNWWQCH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |