C16H23ClN2O4S — CID 119968215
methyl 4-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)-2-methylbenzoate;hydrochloride (PubChem CID 119968215) has the molecular formula C16H23ClN2O4S and a molecular weight of 374.89 g/mol. Its IUPAC name is methyl 4-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)-2-methylbenzoate;hydrochloride.
| Compound Name | methyl 4-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)-2-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 119968215 |
| Molecular Formula | C16H23ClN2O4S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | methyl 4-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)-2-methylbenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC2CC3CCC(C2)N3)cc1C.Cl |
| InChI | InChI=1S/C16H22N2O4S.ClH/c1-10-7-14(5-6-15(10)16(19)22-2)23(20,21)18-13-8-11-3-4-12(9-13)17-11;/h5-7,11-13,17-18H,3-4,8-9H2,1-2H3;1H |
| InChIKey | JIOSEKQPRGMRAU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |