C14H20ClN3O3S — CID 119967652
3-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)benzamide;hydrochloride (PubChem CID 119967652) has the molecular formula C14H20ClN3O3S and a molecular weight of 345.85 g/mol. Its IUPAC name is 3-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)benzamide;hydrochloride.
| Compound Name | 3-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119967652 |
| Molecular Formula | C14H20ClN3O3S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-(8-azabicyclo[3.2.1]octan-3-ylsulfamoyl)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(S(=O)(=O)NC2CC3CCC(C2)N3)c1 |
| InChI | InChI=1S/C14H19N3O3S.ClH/c15-14(18)9-2-1-3-13(6-9)21(19,20)17-12-7-10-4-5-11(8-12)16-10;/h1-3,6,10-12,16-17H,4-5,7-8H2,(H2,15,18);1H |
| InChIKey | GXRFGHDQZPXGEE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |