C15H23ClN2O4S — CID 119966118
methyl 2-methyl-4-[methyl(piperidin-4-yl)sulfamoyl]benzoate;hydrochloride (PubChem CID 119966118) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is methyl 2-methyl-4-[methyl(piperidin-4-yl)sulfamoyl]benzoate;hydrochloride.
| Compound Name | methyl 2-methyl-4-[methyl(piperidin-4-yl)sulfamoyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119966118 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | methyl 2-methyl-4-[methyl(piperidin-4-yl)sulfamoyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(C)C2CCNCC2)cc1C.Cl |
| InChI | InChI=1S/C15H22N2O4S.ClH/c1-11-10-13(4-5-14(11)15(18)21-3)22(19,20)17(2)12-6-8-16-9-7-12;/h4-5,10,12,16H,6-9H2,1-3H3;1H |
| InChIKey | YHMWAWFMERHGMS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |