C11H15NO7S — CID 167848056
(2R)-2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonylamino]butanoic acid (PubChem CID 167848056) has the molecular formula C11H15NO7S and a molecular weight of 305.31 g/mol. Its IUPAC name is (2R)-2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonylamino]butanoic acid.
| Compound Name | (2R)-2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 167848056 |
| Molecular Formula | C11H15NO7S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (2R)-2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonylamino]butanoic acid |
| SMILES | CC[C@@H](NS(=O)(=O)c1cc(C(=O)OC)c(C)o1)C(=O)O |
| InChI | InChI=1S/C11H15NO7S/c1-4-8(10(13)14)12-20(16,17)9-5-7(6(2)19-9)11(15)18-3/h5,8,12H,4H2,1-3H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | UZLBHWADMFWNKV-MRVPVSSYSA-N |
| XLogP | 0.52 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |