C12H17NO8S — CID 126817438
2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonyl-(2-methoxyethyl)amino]acetic acid (PubChem CID 126817438) has the molecular formula C12H17NO8S and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonyl-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonyl-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 126817438 |
| Molecular Formula | C12H17NO8S |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonyl-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)S(=O)(=O)c1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C12H17NO8S/c1-8-9(12(16)20-3)6-11(21-8)22(17,18)13(4-5-19-2)7-10(14)15/h6H,4-5,7H2,1-3H3,(H,14,15) |
| InChIKey | AJVNUYHKOAPDKH-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |