C18H15NO7S2 — CID 67299062
(4-methoxycarbonyl-5-methylfuran-2-yl)sulfonyl-(5-phenylthiophen-3-yl)carbamic acid (PubChem CID 67299062) has the molecular formula C18H15NO7S2 and a molecular weight of 421.45 g/mol. Its IUPAC name is (4-methoxycarbonyl-5-methylfuran-2-yl)sulfonyl-(5-phenylthiophen-3-yl)carbamic acid.
| Compound Name | (4-methoxycarbonyl-5-methylfuran-2-yl)sulfonyl-(5-phenylthiophen-3-yl)carbamic acid |
|---|---|
| PubChem CID | 67299062 |
| Molecular Formula | C18H15NO7S2 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | (4-methoxycarbonyl-5-methylfuran-2-yl)sulfonyl-(5-phenylthiophen-3-yl)carbamic acid |
| SMILES | COC(=O)c1cc(S(=O)(=O)N(C(=O)O)c2csc(-c3ccccc3)c2)oc1C |
| InChI | InChI=1S/C18H15NO7S2/c1-11-14(17(20)25-2)9-16(26-11)28(23,24)19(18(21)22)13-8-15(27-10-13)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,21,22) |
| InChIKey | LUFKZCGNYKJPIS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |