C17H13NO5 — CID 17453114
methyl 2-methyl-5-[(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]furan-3-carboxylate (PubChem CID 17453114) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is methyl 2-methyl-5-[(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 17453114 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 2-methyl-5-[(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(/C=C2\N=C(c3ccccc3)OC2=O)oc1C |
| InChI | InChI=1S/C17H13NO5/c1-10-13(16(19)21-2)8-12(22-10)9-14-17(20)23-15(18-14)11-6-4-3-5-7-11/h3-9H,1-2H3/b14-9- |
| InChIKey | SPKDOCNHGRBKMM-ZROIWOOFSA-N |
| XLogP | 2.72 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|