C19H16N2O6 — CID 24561663
methyl 5-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methylfuran-3-carboxylate (PubChem CID 24561663) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is methyl 5-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 24561663 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | methyl 5-[(Z)-[2-(4-acetamidophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(/C=C2\N=C(c3ccc(NC(C)=O)cc3)OC2=O)oc1C |
| InChI | InChI=1S/C19H16N2O6/c1-10-15(18(23)25-3)8-14(26-10)9-16-19(24)27-17(21-16)12-4-6-13(7-5-12)20-11(2)22/h4-9H,1-3H3,(H,20,22)/b16-9- |
| InChIKey | OMZXXZWUCKIQCF-SXGWCWSVSA-N |
| XLogP | 2.68 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|