C13H11NO5 — CID 10515540
ethyl [(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl] carbonate (PubChem CID 10515540) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is ethyl [(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl] carbonate.
| Compound Name | ethyl [(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl] carbonate |
|---|---|
| PubChem CID | 10515540 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | ethyl [(Z)-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl] carbonate |
| SMILES | CCOC(=O)O/C=C1\N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C13H11NO5/c1-2-17-13(16)18-8-10-12(15)19-11(14-10)9-6-4-3-5-7-9/h3-8H,2H2,1H3/b10-8- |
| InChIKey | SOQZUGGPAISIMS-NTMALXAHSA-N |
| XLogP | 2.00 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|