C14H13NO2 — CID 42603547
(4Z)-4-(3-methylbut-2-enylidene)-2-phenyl-1,3-oxazol-5-one (PubChem CID 42603547) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is (4Z)-4-(3-methylbut-2-enylidene)-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-(3-methylbut-2-enylidene)-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 42603547 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (4Z)-4-(3-methylbut-2-enylidene)-2-phenyl-1,3-oxazol-5-one |
| SMILES | CC(C)=C/C=C1\N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C14H13NO2/c1-10(2)8-9-12-14(16)17-13(15-12)11-6-4-3-5-7-11/h3-9H,1-2H3/b12-9- |
| InChIKey | VEALIUJZTISKIU-XFXZXTDPSA-N |
| XLogP | 2.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|