C15H14N2O2S — CID 3429426
4-[2-(3-methyl-1,3-thiazolidin-2-ylidene)ethylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 3429426) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-[2-(3-methyl-1,3-thiazolidin-2-ylidene)ethylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-[2-(3-methyl-1,3-thiazolidin-2-ylidene)ethylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3429426 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-[2-(3-methyl-1,3-thiazolidin-2-ylidene)ethylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | CN1CCSC1=CC=C1N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C15H14N2O2S/c1-17-9-10-20-13(17)8-7-12-15(18)19-14(16-12)11-5-3-2-4-6-11/h2-8H,9-10H2,1H3 |
| InChIKey | UDKWYZBLDFFYDO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|