C14H14N2O3 — CID 11118732
(4E)-4-(morpholin-4-ylmethylidene)-2-phenyl-1,3-oxazol-5-one (PubChem CID 11118732) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is (4E)-4-(morpholin-4-ylmethylidene)-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-(morpholin-4-ylmethylidene)-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 11118732 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (4E)-4-(morpholin-4-ylmethylidene)-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=N/C1=C/N1CCOCC1 |
| InChI | InChI=1S/C14H14N2O3/c17-14-12(10-16-6-8-18-9-7-16)15-13(19-14)11-4-2-1-3-5-11/h1-5,10H,6-9H2/b12-10+ |
| InChIKey | GODPDKHLWROZLL-ZRDIBKRKSA-N |
| XLogP | 1.16 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|