C26H30N2O7 — CID 136846535
(4E)-2-(4-hydroxyphenyl)-4-[[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 136846535) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is (4E)-2-(4-hydroxyphenyl)-4-[[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-hydroxyphenyl)-4-[[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 136846535 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (4E)-2-(4-hydroxyphenyl)-4-[[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc(O)cc2)=N/C1=C/c1ccc(N2CCOCCOCCOCCOCC2)cc1 |
| InChI | InChI=1S/C26H30N2O7/c29-23-7-3-21(4-8-23)25-27-24(26(30)35-25)19-20-1-5-22(6-2-20)28-9-11-31-13-15-33-17-18-34-16-14-32-12-10-28/h1-8,19,29H,9-18H2/b24-19+ |
| InChIKey | CEICXGVGQSWZSE-LYBHJNIJSA-N |
| XLogP | 2.62 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|