C21H18N2O5 — CID 9313372
(4Z)-2-(1,3-benzodioxol-5-yl)-4-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 9313372) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9313372 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(4-morpholin-4-ylphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc3c(c2)OCO3)=N/C1=C\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H18N2O5/c24-21-17(11-14-1-4-16(5-2-14)23-7-9-25-10-8-23)22-20(28-21)15-3-6-18-19(12-15)27-13-26-18/h1-6,11-12H,7-10,13H2/b17-11- |
| InChIKey | BSNPHVORYGNVAX-BOPFTXTBSA-N |
| XLogP | 2.60 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|