C17H10BrNO4 — CID 590818
2-(1,3-benzodioxol-5-yl)-4-[(3-bromophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 590818) has the molecular formula C17H10BrNO4 and a molecular weight of 372.17 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4-[(3-bromophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4-[(3-bromophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 590818 |
| Molecular Formula | C17H10BrNO4 |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4-[(3-bromophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc3c(c2)OCO3)=NC1=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C17H10BrNO4/c18-12-3-1-2-10(6-12)7-13-17(20)23-16(19-13)11-4-5-14-15(8-11)22-9-21-14/h1-8H,9H2 |
| InChIKey | HQQZJYWQJICAAS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|