C16H9BrN2O4 — CID 46368593
(4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-(5-bromo-3-pyridinyl)-1,3-oxazol-5-one (PubChem CID 46368593) has the molecular formula C16H9BrN2O4 and a molecular weight of 373.16 g/mol. Its IUPAC name is (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-(5-bromo-3-pyridinyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-(5-bromo-3-pyridinyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 46368593 |
| Molecular Formula | C16H9BrN2O4 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | (4Z)-4-(1,3-benzodioxol-5-ylmethylidene)-2-(5-bromo-3-pyridinyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cncc(Br)c2)=N/C1=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H9BrN2O4/c17-11-5-10(6-18-7-11)15-19-12(16(20)23-15)3-9-1-2-13-14(4-9)22-8-21-13/h1-7H,8H2/b12-3- |
| InChIKey | GWVMTBVVDNDUEB-BASWHVEKSA-N |
| XLogP | 2.92 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|